What is the molecular weight of tetraphenylcyclopentadienone?
384.5
Tetraphenylcyclopentadienone
| PubChem CID | 68068 |
|---|---|
| Molecular Formula | C29H20O |
| Synonyms | Tetraphenylcyclopentadienone 479-33-4 Tetracyclone 2,3,4,5-Tetraphenylcyclopenta-2,4-dienone Cyclone More… |
| Molecular Weight | 384.5 |
| Dates | Modify 2021-10-23 Create 2005-03-26 |
What is the molecular weight of benzil?
210.232 g/mol
| IUPAC Name | 1,2-diphenylethane-1,2-dione |
|---|---|
| Alternative Names | BENZIL |
| Molecular Formula | C14H10O2 |
| Molar Mass | 210.232 g/mol |
| InChI | InChI=1S/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H |
What is the mechanism for synthesis of tetraphenylcyclopentadienone?
Tetraphenylcyclopentadienone can be synthesized by a double aldol condensation involving benzil and dibenzyl ketone in the presence of a basic catalyst.
What is the melting point of tetraphenylcyclopentadienone?
217.0°C to 222.0°C
Specifications
| Melting Point | 217.0°C to 222.0°C |
|---|---|
| Formula Weight | 384.47 |
| Physical Form | Fine Crystalline Powder |
| Percent Purity | 99% |
| Chemical Name or Material | Tetraphenylcyclopentadienone, 99% |
Why is tetraphenylcyclopentadienone purple?
The tetraphenylcyclopentadienone is a dark purple color due to extended conjugation; and, it is used for the synthesis of other highly conjugated compounds used in electroluminescent devices.
What is the melting point of Benzil?
94.8 °C
Benzil/Melting point
How do you find the molecular weight of benzil?
Identification of BENZIL Chemical Compound
| Chemical Formula | C14H10O2 |
|---|---|
| Molecular Weight | 210.228 g/mol |
| IUPAC Name | 1,2-diphenylethane-1,2-dione |
| SMILES String | O=C(C(=O)c1ccccc1)c2ccccc2 |
| InChI | InChI=1S/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H |
Why is Tetraphenylcyclopentadienone black?
Why is Tetraphenylcyclopentadienone purple?
Is Diphenylacetylene a Dienophile?
The mechanism for the formation of dimethyl tetraphenylphthalate. In the second reaction, the dienophile is diphenyl acetylene and the reaction is performed neat (i.e., without solvent).
How is tetraphenylcyclopentadienone synthesized in Diels?
Tetraphenylcyclopentadienone can be synthesized by a double aldol condensation involving benzil and dibenzyl ketone in the presence of a basic catalyst. The central ring can act as a diene in Diels–Alder reactions with various dienophiles.
Which is the correct formula for tetraphenylcyclopentadienone?
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).?) Tetraphenylcyclopentadienone is an organic compound with the formula (C 6 H 5) 4 C 4 CO. It is a dark purple to black crystalline solid that is soluble in organic solvents.
What kind of diketone is benzil 1, 2, 3?
Benzil is an alpha-diketone that is ethane-1,2-dione substituted by phenyl groups at positions 1 and 2 respectively. It is an alpha-diketone and an aromatic ketone.
What is the chemical formula for benzil PubChem?
Benzil PubChem CID 8651 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula C14H10O2 Synonyms BENZIL 134-81-6 Diphenylethanedione Dibe