What is common name of phenylamine?
Aniline
Names | |
---|---|
Systematic IUPAC name Benzenamine | |
Other names Phenylamine Aminobenzene Benzamine | |
Identifiers | |
CAS Number | 62-53-3 142-04-1 (HCl) |
What is the Iupac name of benzyl amine?
Phenylmethanamine
Benzylamine is an organic chemical compound with the condensed structural formula C6H5CH2NH2 (sometimes abbreviated as PhCH2NH2 or BnNH2)….Benzylamine.
Names | |
---|---|
Preferred IUPAC name Phenylmethanamine | |
Other names α-Aminotoluene Benzyl amine Phenylmethylamine | |
Identifiers | |
CAS Number | 100-46-9 |
Is aniline accepted Iupac name?
The IUPAC name of aniline is phenylamine.
Is amino benzene the same as phenylamine?

The key difference between phenylamine and aminobenzene is that the name phenylamine describes that aniline has a phenyl group and an amine group whereas the name aminobenzene describes that aniline has an amino group substituted to a benzene ring. Therefore, these are two names for the same compound.
What is the Iupac name of vanillin?
4-hydroxy-3-methoxybenzaldehyde
IUPAC Name | 4-hydroxy-3-methoxybenzaldehyde |
---|---|
Alternative Names | vanillin 4-Hydroxy-3-methoxybenzaldehyde Vanillaldehyde Vanillic aldehyde 2-Methoxy-4-formylphenol |
Molecular Formula | C8H8O3 |
Molar Mass | 152.149 g/mol |
InChI | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
What is the structure of Phenylamine?
Aniline, also known as aminobenzene or phenylamine, has a chemical formula of C6H7N or C6H5NH2 and has 6 carbon (C) atoms, 7 hydrogen (H) atoms, and 1 nitrogen (N) atom. Because carbon is present in its chemical formula, aniline is classified as an organic compound.
What is the IUPAC name of C6H5CH2NH2?
Benzylamine
Benzylamine is an organic chemical compound with the condensed structural formula C6H5CH2NH2 (sometimes abbreviated as PhCH2NH2 or BnNH2).

What are amines write the IUPAC name of benzyl amine give important use of Teflon?
IUPAC name of benzylamine is phenylmethanamine.
What is the structure of phenylamine?
What is the Iupac name of acetophenone?
Acetophenone
Names | |
---|---|
Preferred IUPAC name 1-Phenylethan-1-one | |
Other names Acetophenone Phenylethanone Phenylacetone Methyl phenyl ketone | |
Identifiers | |
CAS Number | 98-86-2 |
Is Phenylamine a functional group?
Phenylamine is a primary amine – a compound in which one of the hydrogen atoms in an ammonia molecule has been replaced by a hydrocarbon group.
What is the Iupac name of Cinnamaldehyde?
IUPAC Name | (E)-3-phenylprop-2-enal |
---|---|
Alternative Names | cinnamaldehyde trans-Cinnamaldehyde Cinnamic aldehyde (E)-Cinnamaldehyde Cinnamal |
Molecular Formula | C9H8O |
Molar Mass | 132.162 g/mol |
InChI | InChI=1S/C9H8O/c10-8-4-7-9-5-2-1-3-6-9/h1-8H/b7-4+ |